C20H21N3O2S — CID 55958284
N-(2-anilino-2-oxoethyl)-5-(1,3-benzothiazol-2-yl)pentanamide (PubChem CID 55958284) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-5-(1,3-benzothiazol-2-yl)pentanamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-5-(1,3-benzothiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 55958284 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-5-(1,3-benzothiazol-2-yl)pentanamide |
| SMILES | O=C(CCCCc1nc2ccccc2s1)NCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H21N3O2S/c24-18(21-14-19(25)22-15-8-2-1-3-9-15)12-6-7-13-20-23-16-10-4-5-11-17(16)26-20/h1-5,8-11H,6-7,12-14H2,(H,21,24)(H,22,25) |
| InChIKey | MYZNLORHEIDLGM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|