C17H17N3O2S — CID 2472699
4-(1,3-benzothiazol-2-yl)-N-(6-methoxy-3-pyridinyl)butanamide (PubChem CID 2472699) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-(6-methoxy-3-pyridinyl)butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-(6-methoxy-3-pyridinyl)butanamide |
|---|---|
| PubChem CID | 2472699 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-(6-methoxy-3-pyridinyl)butanamide |
| SMILES | COc1ccc(NC(=O)CCCc2nc3ccccc3s2)cn1 |
| InChI | InChI=1S/C17H17N3O2S/c1-22-16-10-9-12(11-18-16)19-15(21)7-4-8-17-20-13-5-2-3-6-14(13)23-17/h2-3,5-6,9-11H,4,7-8H2,1H3,(H,19,21) |
| InChIKey | WFCZHYFMLZPPNK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |