C22H25N3O2S — CID 55782553
4-(1,3-benzothiazol-2-yl)-N-[[3-(butanoylamino)phenyl]methyl]butanamide (PubChem CID 55782553) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[[3-(butanoylamino)phenyl]methyl]butanamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[[3-(butanoylamino)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 55782553 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[[3-(butanoylamino)phenyl]methyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(CNC(=O)CCCc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C22H25N3O2S/c1-2-7-21(27)24-17-9-5-8-16(14-17)15-23-20(26)12-6-13-22-25-18-10-3-4-11-19(18)28-22/h3-5,8-11,14H,2,6-7,12-13,15H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | POQDOMCWOTYDGT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |