C25H28ClN3O3 — CID 19325444
2-[6-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6-oxohexyl]isoindole-1,3-dione (PubChem CID 19325444) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is 2-[6-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6-oxohexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6-oxohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19325444 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[6-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-6-oxohexyl]isoindole-1,3-dione |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H28ClN3O3/c26-20-11-9-19(10-12-20)18-27-14-16-28(17-15-27)23(30)8-2-1-5-13-29-24(31)21-6-3-4-7-22(21)25(29)32/h3-4,6-7,9-12H,1-2,5,8,13-18H2 |
| InChIKey | FVIGISHGXUYRAY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|