C25H24ClN5O4 — CID 55488822
2-[4-[4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione (PubChem CID 55488822) has the molecular formula C25H24ClN5O4 and a molecular weight of 493.95 g/mol. Its IUPAC name is 2-[4-[4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55488822 |
| Molecular Formula | C25H24ClN5O4 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 2-[4-[4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)N1CCN(Cc2nc(-c3ccc(Cl)cc3)no2)CC1 |
| InChI | InChI=1S/C25H24ClN5O4/c26-18-9-7-17(8-10-18)23-27-21(35-28-23)16-29-12-14-30(15-13-29)22(32)6-3-11-31-24(33)19-4-1-2-5-20(19)25(31)34/h1-2,4-5,7-10H,3,6,11-16H2 |
| InChIKey | QOMJMDIJLPIUKN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 99.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|