C22H24ClN5O3S — CID 39586077
N-[4-[4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 39586077) has the molecular formula C22H24ClN5O3S and a molecular weight of 473.99 g/mol. Its IUPAC name is N-[4-[4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 39586077 |
| Molecular Formula | C22H24ClN5O3S |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-[4-[4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CCN(Cc2nc(-c3ccc(Cl)cc3)no2)CC1)c1ccsc1 |
| InChI | InChI=1S/C22H24ClN5O3S/c23-18-5-3-16(4-6-18)21-25-19(31-26-21)14-27-9-11-28(12-10-27)20(29)2-1-8-24-22(30)17-7-13-32-15-17/h3-7,13,15H,1-2,8-12,14H2,(H,24,30) |
| InChIKey | VGIWCOYZWFMMEU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|