C19H21Cl2N3O4S2 — CID 30485343
N-[4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 30485343) has the molecular formula C19H21Cl2N3O4S2 and a molecular weight of 490.43 g/mol. Its IUPAC name is N-[4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 30485343 |
| Molecular Formula | C19H21Cl2N3O4S2 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | N-[4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1)c1ccsc1 |
| InChI | InChI=1S/C19H21Cl2N3O4S2/c20-15-3-4-16(21)17(12-15)30(27,28)24-9-7-23(8-10-24)18(25)2-1-6-22-19(26)14-5-11-29-13-14/h3-5,11-13H,1-2,6-10H2,(H,22,26) |
| InChIKey | RQWNYRLKZJHJMM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|