C17H23Cl2N3O4S — CID 55363276
4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-oxo-N-propylbutanamide (PubChem CID 55363276) has the molecular formula C17H23Cl2N3O4S and a molecular weight of 436.36 g/mol. Its IUPAC name is 4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-oxo-N-propylbutanamide.
| Compound Name | 4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-oxo-N-propylbutanamide |
|---|---|
| PubChem CID | 55363276 |
| Molecular Formula | C17H23Cl2N3O4S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 4-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-oxo-N-propylbutanamide |
| SMILES | CCCNC(=O)CCC(=O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H23Cl2N3O4S/c1-2-7-20-16(23)5-6-17(24)21-8-10-22(11-9-21)27(25,26)15-12-13(18)3-4-14(15)19/h3-4,12H,2,5-11H2,1H3,(H,20,23) |
| InChIKey | XTGQHCRXPQLQDA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |