C12H17Cl2N2O2S+ — CID 6957242
1-(2,5-dichlorophenyl)sulfonyl-4-ethylpiperazin-4-ium (PubChem CID 6957242) has the molecular formula C12H17Cl2N2O2S+ and a molecular weight of 324.25 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-4-ethylpiperazin-4-ium.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-4-ethylpiperazin-4-ium |
|---|---|
| PubChem CID | 6957242 |
| Molecular Formula | C12H17Cl2N2O2S+ |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-4-ethylpiperazin-4-ium |
| SMILES | CC[NH+]1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C12H16Cl2N2O2S/c1-2-15-5-7-16(8-6-15)19(17,18)12-9-10(13)3-4-11(12)14/h3-4,9H,2,5-8H2,1H3/p+1 |
| InChIKey | MOLUHZAMKYWOSR-UHFFFAOYSA-O |
| XLogP | 0.90 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |