C17H18Cl2FN2O2S+ — CID 4107120
1-(2,5-dichlorophenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazin-4-ium (PubChem CID 4107120) has the molecular formula C17H18Cl2FN2O2S+ and a molecular weight of 404.31 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 4107120 |
| Molecular Formula | C17H18Cl2FN2O2S+ |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazin-4-ium |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Cl)N1CC[NH+](Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H17Cl2FN2O2S/c18-14-4-5-16(19)17(11-14)25(23,24)22-8-6-21(7-9-22)12-13-2-1-3-15(20)10-13/h1-5,10-11H,6-9,12H2/p+1 |
| InChIKey | BTKJDYCVDWLPMP-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |