C18H21Cl2N2O3S+ — CID 8758193
1-(2,3-dichlorophenyl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazin-4-ium (PubChem CID 8758193) has the molecular formula C18H21Cl2N2O3S+ and a molecular weight of 416.35 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(2,3-dichlorophenyl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 8758193 |
| Molecular Formula | C18H21Cl2N2O3S+ |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 1-(2,3-dichlorophenyl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazin-4-ium |
| SMILES | COc1cccc(C[NH+]2CCN(S(=O)(=O)c3cccc(Cl)c3Cl)CC2)c1 |
| InChI | InChI=1S/C18H20Cl2N2O3S/c1-25-15-5-2-4-14(12-15)13-21-8-10-22(11-9-21)26(23,24)17-7-3-6-16(19)18(17)20/h2-7,12H,8-11,13H2,1H3/p+1 |
| InChIKey | HXNVQSIHYIWREJ-UHFFFAOYSA-O |
| XLogP | 2.09 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |