C18H21ClFN2O3S+ — CID 4249955
1-(5-chloro-2-methoxyphenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazin-4-ium (PubChem CID 4249955) has the molecular formula C18H21ClFN2O3S+ and a molecular weight of 399.90 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 4249955 |
| Molecular Formula | C18H21ClFN2O3S+ |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazin-4-ium |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CC[NH+](Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H20ClFN2O3S/c1-25-17-6-5-15(19)12-18(17)26(23,24)22-9-7-21(8-10-22)13-14-3-2-4-16(20)11-14/h2-6,11-12H,7-10,13H2,1H3/p+1 |
| InChIKey | DHDVWTTZQHEHOZ-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |