C19H24ClN2O4S+ — CID 5092977
1-(5-chloro-2-methoxyphenyl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazin-4-ium (PubChem CID 5092977) has the molecular formula C19H24ClN2O4S+ and a molecular weight of 411.93 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 5092977 |
| Molecular Formula | C19H24ClN2O4S+ |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-[(3-methoxyphenyl)methyl]piperazin-4-ium |
| SMILES | COc1cccc(C[NH+]2CCN(S(=O)(=O)c3cc(Cl)ccc3OC)CC2)c1 |
| InChI | InChI=1S/C19H23ClN2O4S/c1-25-17-5-3-4-15(12-17)14-21-8-10-22(11-9-21)27(23,24)19-13-16(20)6-7-18(19)26-2/h3-7,12-13H,8-11,14H2,1-2H3/p+1 |
| InChIKey | YSFMOXHNUNYOTC-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |