C18H22N3O5S+ — CID 7336674
1-[(3-methoxyphenyl)methyl]-4-(3-nitrophenyl)sulfonylpiperazin-1-ium (PubChem CID 7336674) has the molecular formula C18H22N3O5S+ and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-4-(3-nitrophenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-4-(3-nitrophenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 7336674 |
| Molecular Formula | C18H22N3O5S+ |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-4-(3-nitrophenyl)sulfonylpiperazin-1-ium |
| SMILES | COc1cccc(C[NH+]2CCN(S(=O)(=O)c3cccc([N+](=O)[O-])c3)CC2)c1 |
| InChI | InChI=1S/C18H21N3O5S/c1-26-17-6-2-4-15(12-17)14-19-8-10-20(11-9-19)27(24,25)18-7-3-5-16(13-18)21(22)23/h2-7,12-13H,8-11,14H2,1H3/p+1 |
| InChIKey | RWAHFCNFECQNOL-UHFFFAOYSA-O |
| XLogP | 0.69 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|