C18H22FN2O+ — CID 6939415
1-(4-fluorophenyl)-4-[(3-methoxyphenyl)methyl]piperazin-4-ium (PubChem CID 6939415) has the molecular formula C18H22FN2O+ and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(3-methoxyphenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(4-fluorophenyl)-4-[(3-methoxyphenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 6939415 |
| Molecular Formula | C18H22FN2O+ |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(3-methoxyphenyl)methyl]piperazin-4-ium |
| SMILES | COc1cccc(C[NH+]2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C18H21FN2O/c1-22-18-4-2-3-15(13-18)14-20-9-11-21(12-10-20)17-7-5-16(19)6-8-17/h2-8,13H,9-12,14H2,1H3/p+1 |
| InChIKey | AQBOICQBLRHHOK-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 16.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |