C24H35N2O2+ — CID 7081647
4-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-2,6-di(propan-2-yl)phenol (PubChem CID 7081647) has the molecular formula C24H35N2O2+ and a molecular weight of 383.56 g/mol. Its IUPAC name is 4-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-2,6-di(propan-2-yl)phenol.
| Compound Name | 4-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-2,6-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 7081647 |
| Molecular Formula | C24H35N2O2+ |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 4-[[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-2,6-di(propan-2-yl)phenol |
| SMILES | COc1ccc(N2CC[NH+](Cc3cc(C(C)C)c(O)c(C(C)C)c3)CC2)cc1 |
| InChI | InChI=1S/C24H34N2O2/c1-17(2)22-14-19(15-23(18(3)4)24(22)27)16-25-10-12-26(13-11-25)20-6-8-21(28-5)9-7-20/h6-9,14-15,17-18,27H,10-13,16H2,1-5H3/p+1 |
| InChIKey | JDRKZVNXMWECLM-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 37.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|