C23H32N3O3+ — CID 8587240
N-[(4-ethoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-methylacetamide (PubChem CID 8587240) has the molecular formula C23H32N3O3+ and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-methylacetamide.
| Compound Name | N-[(4-ethoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 8587240 |
| Molecular Formula | C23H32N3O3+ |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N-[(4-ethoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-methylacetamide |
| SMILES | CCOc1ccc(CN(C)C(=O)C[NH+]2CCN(c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H31N3O3/c1-4-29-22-9-5-19(6-10-22)17-24(2)23(27)18-25-13-15-26(16-14-25)20-7-11-21(28-3)12-8-20/h5-12H,4,13-18H2,1-3H3/p+1 |
| InChIKey | KTFWDBYFMJZTMM-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 46.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|