C19H26N5O+ — CID 8542339
N-methyl-N-[(4-methylphenyl)methyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8542339) has the molecular formula C19H26N5O+ and a molecular weight of 340.45 g/mol. Its IUPAC name is N-methyl-N-[(4-methylphenyl)methyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-methyl-N-[(4-methylphenyl)methyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8542339 |
| Molecular Formula | C19H26N5O+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | N-methyl-N-[(4-methylphenyl)methyl]-2-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)acetamide |
| SMILES | Cc1ccc(CN(C)C(=O)C[NH+]2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C19H25N5O/c1-16-4-6-17(7-5-16)14-22(2)18(25)15-23-10-12-24(13-11-23)19-20-8-3-9-21-19/h3-9H,10-15H2,1-2H3/p+1 |
| InChIKey | ISGRJHJEJJPCRA-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |