C17H26N3O2+ — CID 9305006
(3S)-1-[2-[methyl-[(4-methylphenyl)methyl]amino]-2-oxoethyl]piperidin-1-ium-3-carboxamide (PubChem CID 9305006) has the molecular formula C17H26N3O2+ and a molecular weight of 304.41 g/mol. Its IUPAC name is (3S)-1-[2-[methyl-[(4-methylphenyl)methyl]amino]-2-oxoethyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3S)-1-[2-[methyl-[(4-methylphenyl)methyl]amino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9305006 |
| Molecular Formula | C17H26N3O2+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (3S)-1-[2-[methyl-[(4-methylphenyl)methyl]amino]-2-oxoethyl]piperidin-1-ium-3-carboxamide |
| SMILES | Cc1ccc(CN(C)C(=O)C[NH+]2CCC[C@H](C(N)=O)C2)cc1 |
| InChI | InChI=1S/C17H25N3O2/c1-13-5-7-14(8-6-13)10-19(2)16(21)12-20-9-3-4-15(11-20)17(18)22/h5-8,15H,3-4,9-12H2,1-2H3,(H2,18,22)/p+1/t15-/m0/s1 |
| InChIKey | WDOONBCYQUOIIM-HNNXBMFYSA-O |
| XLogP | -0.27 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |