C17H26N3O3+ — CID 8530716
1-[2-[(3-methoxyphenyl)methyl-methylamino]-2-oxoethyl]piperidin-1-ium-4-carboxamide (PubChem CID 8530716) has the molecular formula C17H26N3O3+ and a molecular weight of 320.41 g/mol. Its IUPAC name is 1-[2-[(3-methoxyphenyl)methyl-methylamino]-2-oxoethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-[(3-methoxyphenyl)methyl-methylamino]-2-oxoethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8530716 |
| Molecular Formula | C17H26N3O3+ |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-[2-[(3-methoxyphenyl)methyl-methylamino]-2-oxoethyl]piperidin-1-ium-4-carboxamide |
| SMILES | COc1cccc(CN(C)C(=O)C[NH+]2CCC(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-19(11-13-4-3-5-15(10-13)23-2)16(21)12-20-8-6-14(7-9-20)17(18)22/h3-5,10,14H,6-9,11-12H2,1-2H3,(H2,18,22)/p+1 |
| InChIKey | AFYPFSVVPJQNPN-UHFFFAOYSA-O |
| XLogP | -0.57 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |