C17H21N2O+ — CID 6938276
(3S)-1-(naphthalen-2-ylmethyl)piperidin-1-ium-3-carboxamide (PubChem CID 6938276) has the molecular formula C17H21N2O+ and a molecular weight of 269.37 g/mol. Its IUPAC name is (3S)-1-(naphthalen-2-ylmethyl)piperidin-1-ium-3-carboxamide.
| Compound Name | (3S)-1-(naphthalen-2-ylmethyl)piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 6938276 |
| Molecular Formula | C17H21N2O+ |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (3S)-1-(naphthalen-2-ylmethyl)piperidin-1-ium-3-carboxamide |
| SMILES | NC(=O)[C@H]1CCC[NH+](Cc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C17H20N2O/c18-17(20)16-6-3-9-19(12-16)11-13-7-8-14-4-1-2-5-15(14)10-13/h1-2,4-5,7-8,10,16H,3,6,9,11-12H2,(H2,18,20)/p+1/t16-/m0/s1 |
| InChIKey | FVNDYMXSBAPSHU-INIZCTEOSA-O |
| XLogP | 1.12 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |