C18H26ClN2O+ — CID 7344773
[(3R)-1-[(3-chlorophenyl)methyl]piperidin-1-ium-3-yl]-piperidin-1-ylmethanone (PubChem CID 7344773) has the molecular formula C18H26ClN2O+ and a molecular weight of 321.87 g/mol. Its IUPAC name is [(3R)-1-[(3-chlorophenyl)methyl]piperidin-1-ium-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [(3R)-1-[(3-chlorophenyl)methyl]piperidin-1-ium-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 7344773 |
| Molecular Formula | C18H26ClN2O+ |
| Molecular Weight | 321.87 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | [(3R)-1-[(3-chlorophenyl)methyl]piperidin-1-ium-3-yl]-piperidin-1-ylmethanone |
| SMILES | O=C([C@@H]1CCC[NH+](Cc2cccc(Cl)c2)C1)N1CCCCC1 |
| InChI | InChI=1S/C18H25ClN2O/c19-17-8-4-6-15(12-17)13-20-9-5-7-16(14-20)18(22)21-10-2-1-3-11-21/h4,6,8,12,16H,1-3,5,7,9-11,13-14H2/p+1/t16-/m1/s1 |
| InChIKey | YTTDGPNIVAPBFP-MRXNPFEDSA-O |
| XLogP | 2.15 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.87 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |