C19H28FN2O+ — CID 7472159
azepan-1-yl-[(3S)-1-[(2-fluorophenyl)methyl]piperidin-1-ium-3-yl]methanone (PubChem CID 7472159) has the molecular formula C19H28FN2O+ and a molecular weight of 319.44 g/mol. Its IUPAC name is azepan-1-yl-[(3S)-1-[(2-fluorophenyl)methyl]piperidin-1-ium-3-yl]methanone.
| Compound Name | azepan-1-yl-[(3S)-1-[(2-fluorophenyl)methyl]piperidin-1-ium-3-yl]methanone |
|---|---|
| PubChem CID | 7472159 |
| Molecular Formula | C19H28FN2O+ |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | azepan-1-yl-[(3S)-1-[(2-fluorophenyl)methyl]piperidin-1-ium-3-yl]methanone |
| SMILES | O=C([C@H]1CCC[NH+](Cc2ccccc2F)C1)N1CCCCCC1 |
| InChI | InChI=1S/C19H27FN2O/c20-18-10-4-3-8-16(18)14-21-11-7-9-17(15-21)19(23)22-12-5-1-2-6-13-22/h3-4,8,10,17H,1-2,5-7,9,11-15H2/p+1/t17-/m0/s1 |
| InChIKey | YNWMNHOJYFOXBK-KRWDZBQOSA-O |
| XLogP | 2.02 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |