C19H29N2O2+ — CID 4746691
[1-[(2-methoxyphenyl)methyl]piperidin-1-ium-3-yl]-piperidin-1-ylmethanone (PubChem CID 4746691) has the molecular formula C19H29N2O2+ and a molecular weight of 317.45 g/mol. Its IUPAC name is [1-[(2-methoxyphenyl)methyl]piperidin-1-ium-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-[(2-methoxyphenyl)methyl]piperidin-1-ium-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 4746691 |
| Molecular Formula | C19H29N2O2+ |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | [1-[(2-methoxyphenyl)methyl]piperidin-1-ium-3-yl]-piperidin-1-ylmethanone |
| SMILES | COc1ccccc1C[NH+]1CCCC(C(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C19H28N2O2/c1-23-18-10-4-3-8-16(18)14-20-11-7-9-17(15-20)19(22)21-12-5-2-6-13-21/h3-4,8,10,17H,2,5-7,9,11-15H2,1H3/p+1 |
| InChIKey | CNCJLNINHHPJGZ-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |