C22H29N2O+ — CID 7344787
[(3S)-1-(naphthalen-1-ylmethyl)piperidin-1-ium-3-yl]-piperidin-1-ylmethanone (PubChem CID 7344787) has the molecular formula C22H29N2O+ and a molecular weight of 337.49 g/mol. Its IUPAC name is [(3S)-1-(naphthalen-1-ylmethyl)piperidin-1-ium-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [(3S)-1-(naphthalen-1-ylmethyl)piperidin-1-ium-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 7344787 |
| Molecular Formula | C22H29N2O+ |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | [(3S)-1-(naphthalen-1-ylmethyl)piperidin-1-ium-3-yl]-piperidin-1-ylmethanone |
| SMILES | O=C([C@H]1CCC[NH+](Cc2cccc3ccccc23)C1)N1CCCCC1 |
| InChI | InChI=1S/C22H28N2O/c25-22(24-14-4-1-5-15-24)20-11-7-13-23(17-20)16-19-10-6-9-18-8-2-3-12-21(18)19/h2-3,6,8-10,12,20H,1,4-5,7,11,13-17H2/p+1/t20-/m0/s1 |
| InChIKey | DKAZKQVGVCZXNP-FQEVSTJZSA-O |
| XLogP | 2.65 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |