C21H33N2O+ — CID 7344238
azepan-1-yl-[(3S)-1-(3-phenylpropyl)piperidin-1-ium-3-yl]methanone (PubChem CID 7344238) has the molecular formula C21H33N2O+ and a molecular weight of 329.51 g/mol. Its IUPAC name is azepan-1-yl-[(3S)-1-(3-phenylpropyl)piperidin-1-ium-3-yl]methanone.
| Compound Name | azepan-1-yl-[(3S)-1-(3-phenylpropyl)piperidin-1-ium-3-yl]methanone |
|---|---|
| PubChem CID | 7344238 |
| Molecular Formula | C21H33N2O+ |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | azepan-1-yl-[(3S)-1-(3-phenylpropyl)piperidin-1-ium-3-yl]methanone |
| SMILES | O=C([C@H]1CCC[NH+](CCCc2ccccc2)C1)N1CCCCCC1 |
| InChI | InChI=1S/C21H32N2O/c24-21(23-16-6-1-2-7-17-23)20-13-9-15-22(18-20)14-8-12-19-10-4-3-5-11-19/h3-5,10-11,20H,1-2,6-9,12-18H2/p+1/t20-/m0/s1 |
| InChIKey | NZRUILYHRIXQRG-FQEVSTJZSA-O |
| XLogP | 2.32 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |