C21H33N2O+ — CID 6945790
(4-methylpiperidin-1-yl)-[1-(3-phenylpropyl)piperidin-1-ium-4-yl]methanone (PubChem CID 6945790) has the molecular formula C21H33N2O+ and a molecular weight of 329.51 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[1-(3-phenylpropyl)piperidin-1-ium-4-yl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[1-(3-phenylpropyl)piperidin-1-ium-4-yl]methanone |
|---|---|
| PubChem CID | 6945790 |
| Molecular Formula | C21H33N2O+ |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[1-(3-phenylpropyl)piperidin-1-ium-4-yl]methanone |
| SMILES | CC1CCN(C(=O)C2CC[NH+](CCCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C21H32N2O/c1-18-9-16-23(17-10-18)21(24)20-11-14-22(15-12-20)13-5-8-19-6-3-2-4-7-19/h2-4,6-7,18,20H,5,8-17H2,1H3/p+1 |
| InChIKey | QNRHKSZNPGFUGL-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |