C20H24FN2O+ — CID 4743163
(4-fluorophenyl)-[4-(3-phenylpropyl)piperazin-4-ium-1-yl]methanone (PubChem CID 4743163) has the molecular formula C20H24FN2O+ and a molecular weight of 327.42 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-(3-phenylpropyl)piperazin-4-ium-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[4-(3-phenylpropyl)piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 4743163 |
| Molecular Formula | C20H24FN2O+ |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (4-fluorophenyl)-[4-(3-phenylpropyl)piperazin-4-ium-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CC[NH+](CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23FN2O/c21-19-10-8-18(9-11-19)20(24)23-15-13-22(14-16-23)12-4-7-17-5-2-1-3-6-17/h1-3,5-6,8-11H,4,7,12-16H2/p+1 |
| InChIKey | SXLJDHZUHDDLCC-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |