C23H31N2O3+ — CID 7346840
(3,4-diethoxyphenyl)-[4-(2-phenylethyl)piperazin-4-ium-1-yl]methanone (PubChem CID 7346840) has the molecular formula C23H31N2O3+ and a molecular weight of 383.51 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-[4-(2-phenylethyl)piperazin-4-ium-1-yl]methanone.
| Compound Name | (3,4-diethoxyphenyl)-[4-(2-phenylethyl)piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 7346840 |
| Molecular Formula | C23H31N2O3+ |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (3,4-diethoxyphenyl)-[4-(2-phenylethyl)piperazin-4-ium-1-yl]methanone |
| SMILES | CCOc1ccc(C(=O)N2CC[NH+](CCc3ccccc3)CC2)cc1OCC |
| InChI | InChI=1S/C23H30N2O3/c1-3-27-21-11-10-20(18-22(21)28-4-2)23(26)25-16-14-24(15-17-25)13-12-19-8-6-5-7-9-19/h5-11,18H,3-4,12-17H2,1-2H3/p+1 |
| InChIKey | VRUXUCMTIDHMSW-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |