C15H23ClN2O3 — CID 119400534
(3,4-diethoxyphenyl)-piperazin-1-ylmethanone;hydrochloride (PubChem CID 119400534) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | (3,4-diethoxyphenyl)-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119400534 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (3,4-diethoxyphenyl)-piperazin-1-ylmethanone;hydrochloride |
| SMILES | CCOc1ccc(C(=O)N2CCNCC2)cc1OCC.Cl |
| InChI | InChI=1S/C15H22N2O3.ClH/c1-3-19-13-6-5-12(11-14(13)20-4-2)15(18)17-9-7-16-8-10-17;/h5-6,11,16H,3-4,7-10H2,1-2H3;1H |
| InChIKey | WYGGBCOMZAERKK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |