C23H34N2O4 — CID 112793126
2-[4-(azocane-1-carbonyl)-2-ethoxyphenoxy]-1-piperidin-1-ylethanone (PubChem CID 112793126) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[4-(azocane-1-carbonyl)-2-ethoxyphenoxy]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-(azocane-1-carbonyl)-2-ethoxyphenoxy]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 112793126 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 2-[4-(azocane-1-carbonyl)-2-ethoxyphenoxy]-1-piperidin-1-ylethanone |
| SMILES | CCOc1cc(C(=O)N2CCCCCCC2)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H34N2O4/c1-2-28-21-17-19(23(27)25-15-7-4-3-5-8-16-25)11-12-20(21)29-18-22(26)24-13-9-6-10-14-24/h11-12,17H,2-10,13-16,18H2,1H3 |
| InChIKey | GOGYDIKKYONVCC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |