C20H28N2O6 — CID 100641368
(2R)-2-[[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoyl]-methylamino]propanoic acid (PubChem CID 100641368) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is (2R)-2-[[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoyl]-methylamino]propanoic acid.
| Compound Name | (2R)-2-[[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 100641368 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (2R)-2-[[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoyl]-methylamino]propanoic acid |
| SMILES | CCOc1cc(C(=O)N(C)[C@H](C)C(=O)O)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H28N2O6/c1-4-27-17-12-15(19(24)21(3)14(2)20(25)26)8-9-16(17)28-13-18(23)22-10-6-5-7-11-22/h8-9,12,14H,4-7,10-11,13H2,1-3H3,(H,25,26)/t14-/m1/s1 |
| InChIKey | AQRHBMALTIBCQQ-CQSZACIVSA-N |
| XLogP | 2.02 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |