C28H32N2O4 — CID 60607400
3-ethoxy-N-ethyl-N-naphthalen-2-yl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide (PubChem CID 60607400) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 3-ethoxy-N-ethyl-N-naphthalen-2-yl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide.
| Compound Name | 3-ethoxy-N-ethyl-N-naphthalen-2-yl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
|---|---|
| PubChem CID | 60607400 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 3-ethoxy-N-ethyl-N-naphthalen-2-yl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)N(CC)c2ccc3ccccc3c2)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C28H32N2O4/c1-3-30(24-14-12-21-10-6-7-11-22(21)18-24)28(32)23-13-15-25(26(19-23)33-4-2)34-20-27(31)29-16-8-5-9-17-29/h6-7,10-15,18-19H,3-5,8-9,16-17,20H2,1-2H3 |
| InChIKey | ORMLBDACDXXZNZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |