C24H30N2O4 — CID 29260956
N-benzyl-3-ethoxy-N-methyl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide (PubChem CID 29260956) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is N-benzyl-3-ethoxy-N-methyl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide.
| Compound Name | N-benzyl-3-ethoxy-N-methyl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
|---|---|
| PubChem CID | 29260956 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-benzyl-3-ethoxy-N-methyl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)N(C)Cc2ccccc2)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C24H30N2O4/c1-3-29-22-16-20(24(28)25(2)17-19-10-6-4-7-11-19)12-13-21(22)30-18-23(27)26-14-8-5-9-15-26/h4,6-7,10-13,16H,3,5,8-9,14-15,17-18H2,1-2H3 |
| InChIKey | GPHYWIQGRCGTCS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |