C26H33N3O5 — CID 55724935
3-ethoxy-N-[[3-(ethylcarbamoyl)phenyl]methyl]-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide (PubChem CID 55724935) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-ethoxy-N-[[3-(ethylcarbamoyl)phenyl]methyl]-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide.
| Compound Name | 3-ethoxy-N-[[3-(ethylcarbamoyl)phenyl]methyl]-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
|---|---|
| PubChem CID | 55724935 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 3-ethoxy-N-[[3-(ethylcarbamoyl)phenyl]methyl]-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
| SMILES | CCNC(=O)c1cccc(CNC(=O)c2ccc(OCC(=O)N3CCCCC3)c(OCC)c2)c1 |
| InChI | InChI=1S/C26H33N3O5/c1-3-27-25(31)20-10-8-9-19(15-20)17-28-26(32)21-11-12-22(23(16-21)33-4-2)34-18-24(30)29-13-6-5-7-14-29/h8-12,15-16H,3-7,13-14,17-18H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | UOQXHBPOTBEBJC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |