C21H27N3O6S2 — CID 55339765
3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide (PubChem CID 55339765) has the molecular formula C21H27N3O6S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide.
| Compound Name | 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55339765 |
| Molecular Formula | C21H27N3O6S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)-N-[(5-sulfamoylthiophen-2-yl)methyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCc2ccc(S(N)(=O)=O)s2)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H27N3O6S2/c1-2-29-18-12-15(21(26)23-13-16-7-9-20(31-16)32(22,27)28)6-8-17(18)30-14-19(25)24-10-4-3-5-11-24/h6-9,12H,2-5,10-11,13-14H2,1H3,(H,23,26)(H2,22,27,28) |
| InChIKey | ZPMRHPWQXUHBFN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |