C23H34N2O7 — CID 55726487
ethyl 2-[[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoyl]-(2-methoxyethyl)amino]acetate (PubChem CID 55726487) has the molecular formula C23H34N2O7 and a molecular weight of 450.53 g/mol. Its IUPAC name is ethyl 2-[[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoyl]-(2-methoxyethyl)amino]acetate.
| Compound Name | ethyl 2-[[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoyl]-(2-methoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 55726487 |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | ethyl 2-[[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoyl]-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)c1ccc(OCC(=O)N2CCCCC2)c(OCC)c1 |
| InChI | InChI=1S/C23H34N2O7/c1-4-30-20-15-18(23(28)25(13-14-29-3)16-22(27)31-5-2)9-10-19(20)32-17-21(26)24-11-7-6-8-12-24/h9-10,15H,4-8,11-14,16-17H2,1-3H3 |
| InChIKey | LXOAJRCGJOIDON-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |