C23H27ClN2O4 — CID 26087154
N-(3-chloro-4-methylphenyl)-3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide (PubChem CID 26087154) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
|---|---|
| PubChem CID | 26087154 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(C)c(Cl)c2)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H27ClN2O4/c1-3-29-21-13-17(23(28)25-18-9-7-16(2)19(24)14-18)8-10-20(21)30-15-22(27)26-11-5-4-6-12-26/h7-10,13-14H,3-6,11-12,15H2,1-2H3,(H,25,28) |
| InChIKey | QJOZDTSHWGHDBY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |