C26H34N2O5 — CID 43033984
3-ethoxy-N-methyl-N-[2-(2-methylphenoxy)ethyl]-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide (PubChem CID 43033984) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-ethoxy-N-methyl-N-[2-(2-methylphenoxy)ethyl]-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide.
| Compound Name | 3-ethoxy-N-methyl-N-[2-(2-methylphenoxy)ethyl]-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
|---|---|
| PubChem CID | 43033984 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 3-ethoxy-N-methyl-N-[2-(2-methylphenoxy)ethyl]-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)N(C)CCOc2ccccc2C)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C26H34N2O5/c1-4-31-24-18-21(12-13-23(24)33-19-25(29)28-14-8-5-9-15-28)26(30)27(3)16-17-32-22-11-7-6-10-20(22)2/h6-7,10-13,18H,4-5,8-9,14-17,19H2,1-3H3 |
| InChIKey | RPSCXPSHCHDVBN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |