C15H21NO3 — CID 112788345
2-(2-propoxyphenoxy)-1-pyrrolidin-1-ylethanone (PubChem CID 112788345) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-(2-propoxyphenoxy)-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-(2-propoxyphenoxy)-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 112788345 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-(2-propoxyphenoxy)-1-pyrrolidin-1-ylethanone |
| SMILES | CCCOc1ccccc1OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C15H21NO3/c1-2-11-18-13-7-3-4-8-14(13)19-12-15(17)16-9-5-6-10-16/h3-4,7-8H,2,5-6,9-12H2,1H3 |
| InChIKey | KCBPKDQIVZJQNY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |