C17H24N2O4 — CID 110799178
ethyl 4-[2-(2-methylphenoxy)acetyl]-1,4-diazepane-1-carboxylate (PubChem CID 110799178) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is ethyl 4-[2-(2-methylphenoxy)acetyl]-1,4-diazepane-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-methylphenoxy)acetyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110799178 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | ethyl 4-[2-(2-methylphenoxy)acetyl]-1,4-diazepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCN(C(=O)COc2ccccc2C)CC1 |
| InChI | InChI=1S/C17H24N2O4/c1-3-22-17(21)19-10-6-9-18(11-12-19)16(20)13-23-15-8-5-4-7-14(15)2/h4-5,7-8H,3,6,9-13H2,1-2H3 |
| InChIKey | ZQOORAWFNVHCFP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |