C26H34N2O4 — CID 108547093
1-[4-[2-(2-ethylphenoxy)acetyl]-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one (PubChem CID 108547093) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 1-[4-[2-(2-ethylphenoxy)acetyl]-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one.
| Compound Name | 1-[4-[2-(2-ethylphenoxy)acetyl]-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 108547093 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 1-[4-[2-(2-ethylphenoxy)acetyl]-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one |
| SMILES | CCc1ccccc1OCC(=O)N1CCCN(C(=O)CCCOc2ccccc2C)CC1 |
| InChI | InChI=1S/C26H34N2O4/c1-3-22-11-5-7-13-24(22)32-20-26(30)28-16-9-15-27(17-18-28)25(29)14-8-19-31-23-12-6-4-10-21(23)2/h4-7,10-13H,3,8-9,14-20H2,1-2H3 |
| InChIKey | BSTIIVIZNOMKOP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|