C27H30N2O3 — CID 108547065
4-(2-methylphenoxy)-1-[4-(naphthalene-1-carbonyl)-1,4-diazepan-1-yl]butan-1-one (PubChem CID 108547065) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-1-[4-(naphthalene-1-carbonyl)-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 4-(2-methylphenoxy)-1-[4-(naphthalene-1-carbonyl)-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108547065 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 4-(2-methylphenoxy)-1-[4-(naphthalene-1-carbonyl)-1,4-diazepan-1-yl]butan-1-one |
| SMILES | Cc1ccccc1OCCCC(=O)N1CCCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C27H30N2O3/c1-21-9-2-5-14-25(21)32-20-7-15-26(30)28-16-8-17-29(19-18-28)27(31)24-13-6-11-22-10-3-4-12-23(22)24/h2-6,9-14H,7-8,15-20H2,1H3 |
| InChIKey | DEBWRFXXVMBUCW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|