C25H33N3O3 — CID 108547102
1-[4-[4-(dimethylamino)benzoyl]-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one (PubChem CID 108547102) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-[4-[4-(dimethylamino)benzoyl]-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one.
| Compound Name | 1-[4-[4-(dimethylamino)benzoyl]-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 108547102 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 1-[4-[4-(dimethylamino)benzoyl]-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one |
| SMILES | Cc1ccccc1OCCCC(=O)N1CCCN(C(=O)c2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C25H33N3O3/c1-20-8-4-5-9-23(20)31-19-6-10-24(29)27-15-7-16-28(18-17-27)25(30)21-11-13-22(14-12-21)26(2)3/h4-5,8-9,11-14H,6-7,10,15-19H2,1-3H3 |
| InChIKey | TYQJVVLECXPCSA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|