C24H30N2O3 — CID 55563796
1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one (PubChem CID 55563796) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one.
| Compound Name | 1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 55563796 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 1-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]-4-(2-methylphenoxy)butan-1-one |
| SMILES | Cc1cccc(C(=O)N2CCCN(C(=O)CCCOc3ccccc3C)CC2)c1 |
| InChI | InChI=1S/C24H30N2O3/c1-19-8-5-10-21(18-19)24(28)26-14-7-13-25(15-16-26)23(27)12-6-17-29-22-11-4-3-9-20(22)2/h3-5,8-11,18H,6-7,12-17H2,1-2H3 |
| InChIKey | DRQMYPNUZSZBNR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|