C24H30N2O4 — CID 52859774
5-(2,5-dimethylphenoxy)-1-[4-(3-hydroxybenzoyl)piperazin-1-yl]pentan-1-one (PubChem CID 52859774) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-1-[4-(3-hydroxybenzoyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-(2,5-dimethylphenoxy)-1-[4-(3-hydroxybenzoyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 52859774 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-1-[4-(3-hydroxybenzoyl)piperazin-1-yl]pentan-1-one |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)N2CCN(C(=O)c3cccc(O)c3)CC2)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-18-9-10-19(2)22(16-18)30-15-4-3-8-23(28)25-11-13-26(14-12-25)24(29)20-6-5-7-21(27)17-20/h5-7,9-10,16-17,27H,3-4,8,11-15H2,1-2H3 |
| InChIKey | DLCWKUMFGJPYRX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|