C20H25NO2S — CID 47721238
1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-(2,5-dimethylphenoxy)pentan-1-one (PubChem CID 47721238) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is 1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-(2,5-dimethylphenoxy)pentan-1-one.
| Compound Name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-(2,5-dimethylphenoxy)pentan-1-one |
|---|---|
| PubChem CID | 47721238 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-(2,5-dimethylphenoxy)pentan-1-one |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)N2CCc3sccc3C2)c1 |
| InChI | InChI=1S/C20H25NO2S/c1-15-6-7-16(2)18(13-15)23-11-4-3-5-20(22)21-10-8-19-17(14-21)9-12-24-19/h6-7,9,12-13H,3-5,8,10-11,14H2,1-2H3 |
| InChIKey | UWYMXCNOSGQGOQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|