C22H24Cl2N2O3 — CID 108545192
1-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]-4-(2-chlorophenoxy)butan-1-one (PubChem CID 108545192) has the molecular formula C22H24Cl2N2O3 and a molecular weight of 435.35 g/mol. Its IUPAC name is 1-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]-4-(2-chlorophenoxy)butan-1-one.
| Compound Name | 1-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]-4-(2-chlorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 108545192 |
| Molecular Formula | C22H24Cl2N2O3 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 1-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]-4-(2-chlorophenoxy)butan-1-one |
| SMILES | O=C(CCCOc1ccccc1Cl)N1CCCN(C(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H24Cl2N2O3/c23-18-7-3-6-17(16-18)22(28)26-12-5-11-25(13-14-26)21(27)10-4-15-29-20-9-2-1-8-19(20)24/h1-3,6-9,16H,4-5,10-15H2 |
| InChIKey | IIYUNHCHCYLZOZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|