C18H25ClN2O4 — CID 108536281
4-(2-chlorophenoxy)-1-[4-(3-methoxypropanoyl)piperazin-1-yl]butan-1-one (PubChem CID 108536281) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-1-[4-(3-methoxypropanoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(2-chlorophenoxy)-1-[4-(3-methoxypropanoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108536281 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-(2-chlorophenoxy)-1-[4-(3-methoxypropanoyl)piperazin-1-yl]butan-1-one |
| SMILES | COCCC(=O)N1CCN(C(=O)CCCOc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H25ClN2O4/c1-24-14-8-18(23)21-11-9-20(10-12-21)17(22)7-4-13-25-16-6-3-2-5-15(16)19/h2-3,5-6H,4,7-14H2,1H3 |
| InChIKey | UTJLYPXKUDQFCX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|