C19H22ClNO4 — CID 112800692
3-chloro-5-ethoxy-4-hydroxy-N-methyl-N-[2-(2-methylphenoxy)ethyl]benzamide (PubChem CID 112800692) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is 3-chloro-5-ethoxy-4-hydroxy-N-methyl-N-[2-(2-methylphenoxy)ethyl]benzamide.
| Compound Name | 3-chloro-5-ethoxy-4-hydroxy-N-methyl-N-[2-(2-methylphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 112800692 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-chloro-5-ethoxy-4-hydroxy-N-methyl-N-[2-(2-methylphenoxy)ethyl]benzamide |
| SMILES | CCOc1cc(C(=O)N(C)CCOc2ccccc2C)cc(Cl)c1O |
| InChI | InChI=1S/C19H22ClNO4/c1-4-24-17-12-14(11-15(20)18(17)22)19(23)21(3)9-10-25-16-8-6-5-7-13(16)2/h5-8,11-12,22H,4,9-10H2,1-3H3 |
| InChIKey | DQIINQKKMDZCJN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |